C12H18OS — CID 86203544
1-(2,2-dimethylpropylsulfinyl)-4-methylbenzene (PubChem CID 86203544) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 1-(2,2-dimethylpropylsulfinyl)-4-methylbenzene.
| Compound Name | 1-(2,2-dimethylpropylsulfinyl)-4-methylbenzene |
|---|---|
| PubChem CID | 86203544 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(2,2-dimethylpropylsulfinyl)-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C12H18OS/c1-10-5-7-11(8-6-10)14(13)9-12(2,3)4/h5-8H,9H2,1-4H3 |
| InChIKey | XVQYUKZHZZHXEE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |