C18H24O4S — CID 10616867
4,4-dimethoxy-3,5-dimethyl-1-[[(R)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-ol (PubChem CID 10616867) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is 4,4-dimethoxy-3,5-dimethyl-1-[[(R)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-ol.
| Compound Name | 4,4-dimethoxy-3,5-dimethyl-1-[[(R)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 10616867 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4,4-dimethoxy-3,5-dimethyl-1-[[(R)-(4-methylphenyl)sulfinyl]methyl]cyclohexa-2,5-dien-1-ol |
| SMILES | COC1(OC)C(C)=CC(O)(C[S@@](=O)c2ccc(C)cc2)C=C1C |
| InChI | InChI=1S/C18H24O4S/c1-13-6-8-16(9-7-13)23(20)12-17(19)10-14(2)18(21-4,22-5)15(3)11-17/h6-11,19H,12H2,1-5H3/t23-/m1/s1 |
| InChIKey | UBKPSKHSFUDAKB-HSZRJFAPSA-N |
| XLogP | 2.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|