C21H30O3SSi — CID 10739174
(3S,4S,5S)-3-ethyl-4-hydroxy-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-5-(2-trimethylsilylethynyl)cyclohexan-1-one (PubChem CID 10739174) has the molecular formula C21H30O3SSi and a molecular weight of 390.62 g/mol. Its IUPAC name is (3S,4S,5S)-3-ethyl-4-hydroxy-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-5-(2-trimethylsilylethynyl)cyclohexan-1-one.
| Compound Name | (3S,4S,5S)-3-ethyl-4-hydroxy-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-5-(2-trimethylsilylethynyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 10739174 |
| Molecular Formula | C21H30O3SSi |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (3S,4S,5S)-3-ethyl-4-hydroxy-4-[[(R)-(4-methylphenyl)sulfinyl]methyl]-5-(2-trimethylsilylethynyl)cyclohexan-1-one |
| SMILES | CC[C@H]1CC(=O)C[C@@H](C#C[Si](C)(C)C)[C@]1(O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H30O3SSi/c1-6-17-13-19(22)14-18(11-12-26(3,4)5)21(17,23)15-25(24)20-9-7-16(2)8-10-20/h7-10,17-18,23H,6,13-15H2,1-5H3/t17-,18+,21-,25+/m0/s1 |
| InChIKey | QURKTGHPDOMHQJ-FHHVHTCRSA-N |
| XLogP | 3.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|