C15H17NOS — CID 10730010
(1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carbonitrile (PubChem CID 10730010) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carbonitrile.
| Compound Name | (1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 10730010 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1S,2R,6S)-2-methyl-6-[(R)-(4-methylphenyl)sulfinyl]cyclohex-3-ene-1-carbonitrile |
| SMILES | Cc1ccc([S@](=O)[C@H]2CC=C[C@@H](C)[C@H]2C#N)cc1 |
| InChI | InChI=1S/C15H17NOS/c1-11-6-8-13(9-7-11)18(17)15-5-3-4-12(2)14(15)10-16/h3-4,6-9,12,14-15H,5H2,1-2H3/t12-,14-,15+,18+/m1/s1 |
| InChIKey | URUDIPNIVDSXHJ-TXPWEPMLSA-N |
| XLogP | 3.21 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|