C14H13NO2S — CID 10706419
(1S,2R,3R,4R)-3-[(R)-(4-methylphenyl)sulfinyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile (PubChem CID 10706419) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-[(R)-(4-methylphenyl)sulfinyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile.
| Compound Name | (1S,2R,3R,4R)-3-[(R)-(4-methylphenyl)sulfinyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 10706419 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (1S,2R,3R,4R)-3-[(R)-(4-methylphenyl)sulfinyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carbonitrile |
| SMILES | Cc1ccc([S@](=O)[C@@H]2[C@H](C#N)[C@@H]3C=C[C@H]2O3)cc1 |
| InChI | InChI=1S/C14H13NO2S/c1-9-2-4-10(5-3-9)18(16)14-11(8-15)12-6-7-13(14)17-12/h2-7,11-14H,1H3/t11-,12+,13-,14-,18+/m1/s1 |
| InChIKey | HCCPARUXDHYKJQ-FWIBFFJGSA-N |
| XLogP | 1.95 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|