C23H22N2O3S — CID 53253524
ethyl (1S,2R,3R,10bS)-1-cyano-2-[(R)-(4-methylphenyl)sulfinyl]-1,2,3,10b-tetrahydropyrrolo[2,1-a]isoquinoline-3-carboxylate (PubChem CID 53253524) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is ethyl (1S,2R,3R,10bS)-1-cyano-2-[(R)-(4-methylphenyl)sulfinyl]-1,2,3,10b-tetrahydropyrrolo[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | ethyl (1S,2R,3R,10bS)-1-cyano-2-[(R)-(4-methylphenyl)sulfinyl]-1,2,3,10b-tetrahydropyrrolo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 53253524 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | ethyl (1S,2R,3R,10bS)-1-cyano-2-[(R)-(4-methylphenyl)sulfinyl]-1,2,3,10b-tetrahydropyrrolo[2,1-a]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]([S@@](=O)c2ccc(C)cc2)[C@H](C#N)[C@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C23H22N2O3S/c1-3-28-23(26)21-22(29(27)17-10-8-15(2)9-11-17)19(14-24)20-18-7-5-4-6-16(18)12-13-25(20)21/h4-13,19-22H,3H2,1-2H3/t19-,20-,21+,22-,29+/m1/s1 |
| InChIKey | PDSGBZLDPUVQKS-PAFDTYDNSA-N |
| XLogP | 3.58 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |