C14H17ClOS — CID 5010569
2-chloro-3-(4-methylphenyl)sulfinylbicyclo[2.2.1]heptane (PubChem CID 5010569) has the molecular formula C14H17ClOS and a molecular weight of 268.81 g/mol. Its IUPAC name is 2-chloro-3-(4-methylphenyl)sulfinylbicyclo[2.2.1]heptane.
| Compound Name | 2-chloro-3-(4-methylphenyl)sulfinylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 5010569 |
| Molecular Formula | C14H17ClOS |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-chloro-3-(4-methylphenyl)sulfinylbicyclo[2.2.1]heptane |
| SMILES | Cc1ccc(S(=O)C2C3CCC(C3)C2Cl)cc1 |
| InChI | InChI=1S/C14H17ClOS/c1-9-2-6-12(7-3-9)17(16)14-11-5-4-10(8-11)13(14)15/h2-3,6-7,10-11,13-14H,4-5,8H2,1H3 |
| InChIKey | DGKCHUVGSCHSNA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|