C14H18O2S — CID 102426587
[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfinate (PubChem CID 102426587) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfinate.
| Compound Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 102426587 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)O[C@@H]2C[C@@H]3CC[C@H]2C3)cc1 |
| InChI | InChI=1S/C14H18O2S/c1-10-2-6-13(7-3-10)17(15)16-14-9-11-4-5-12(14)8-11/h2-3,6-7,11-12,14H,4-5,8-9H2,1H3/t11-,12+,14-,17?/m1/s1 |
| InChIKey | KADDNLIEZIWLRZ-KZZCMMSASA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |