C13H14N2O3 — CID 6552517
(3aS,4R,7aS)-4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 6552517) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aS)-4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6552517 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3aS,4R,7aS)-4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)[C@H]3[C@H](C)C=CC[C@@H]3C2=O)no1 |
| InChI | InChI=1S/C13H14N2O3/c1-7-4-3-5-9-11(7)13(17)15(12(9)16)10-6-8(2)18-14-10/h3-4,6-7,9,11H,5H2,1-2H3/t7-,9+,11+/m1/s1 |
| InChIKey | IHGZQBCJDXDNEH-HDBBIHSSSA-N |
| XLogP | 1.68 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|