C12H12Br2N2O3 — CID 3467083
5,6-dibromo-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 3467083) has the molecular formula C12H12Br2N2O3 and a molecular weight of 392.05 g/mol. Its IUPAC name is 5,6-dibromo-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5,6-dibromo-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3467083 |
| Molecular Formula | C12H12Br2N2O3 |
| Molecular Weight | 392.05 g/mol |
| Exact Mass | 389.92 |
| IUPAC Name | 5,6-dibromo-2-(5-methyl-1,2-oxazol-3-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)C3CC(Br)C(Br)CC3C2=O)no1 |
| InChI | InChI=1S/C12H12Br2N2O3/c1-5-2-10(15-19-5)16-11(17)6-3-8(13)9(14)4-7(6)12(16)18/h2,6-9H,3-4H2,1H3 |
| InChIKey | KZLOMWQWZBZOHR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.05 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|