C24H24N2O4 — CID 11900771
(1S,2S,6R,7R)-4-[4-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 11900771) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (1S,2S,6R,7R)-4-[4-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2S,6R,7R)-4-[4-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 11900771 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (1S,2S,6R,7R)-4-[4-[(3aR,4R,7aS)-4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[C@@H]1C=CC[C@@H]2C(=O)N(c3ccc(N4C(=O)[C@@H]5[C@@H]6CC[C@@H](C6)[C@@H]5C4=O)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C24H24N2O4/c1-12-3-2-4-17-18(12)22(28)25(21(17)27)15-7-9-16(10-8-15)26-23(29)19-13-5-6-14(11-13)20(19)24(26)30/h2-3,7-10,12-14,17-20H,4-6,11H2,1H3/t12-,13-,14+,17+,18-,19-,20+/m1/s1 |
| InChIKey | PVRUUSQHGDWMAH-FOEUPKGWSA-N |
| XLogP | 2.92 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|