C21H18ClNO3 — CID 7428585
(3aS,4R,7aS)-2-[4-(2-chlorophenoxy)phenyl]-4-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 7428585) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is (3aS,4R,7aS)-2-[4-(2-chlorophenoxy)phenyl]-4-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aS)-2-[4-(2-chlorophenoxy)phenyl]-4-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7428585 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (3aS,4R,7aS)-2-[4-(2-chlorophenoxy)phenyl]-4-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@@H]1C=CC[C@@H]2C(=O)N(c3ccc(Oc4ccccc4Cl)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H18ClNO3/c1-13-5-4-6-16-19(13)21(25)23(20(16)24)14-9-11-15(12-10-14)26-18-8-3-2-7-17(18)22/h2-5,7-13,16,19H,6H2,1H3/t13-,16+,19+/m1/s1 |
| InChIKey | DQBMCXZHIPBGIK-AZOIQLNYSA-N |
| XLogP | 4.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|