C27H23NO3 — CID 11903399
(3aR,4R,7aS)-4-methyl-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 11903399) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-methyl-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7aS)-4-methyl-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11903399 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (3aR,4R,7aS)-4-methyl-2-[4-(2-phenylphenoxy)phenyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@@H]1C=CC[C@@H]2C(=O)N(c3ccc(Oc4ccccc4-c4ccccc4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H23NO3/c1-18-8-7-12-23-25(18)27(30)28(26(23)29)20-14-16-21(17-15-20)31-24-13-6-5-11-22(24)19-9-3-2-4-10-19/h2-11,13-18,23,25H,12H2,1H3/t18-,23+,25-/m1/s1 |
| InChIKey | KZMHYXGGGZOKJC-FMNCTDSISA-N |
| XLogP | 5.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|