C17H34 — CID 145020168
3,4-dimethylcyclopentene;(Z)-3,4-dimethylhex-2-ene;ethane (PubChem CID 145020168) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is 3,4-dimethylcyclopentene;(Z)-3,4-dimethylhex-2-ene;ethane.
| Compound Name | 3,4-dimethylcyclopentene;(Z)-3,4-dimethylhex-2-ene;ethane |
|---|---|
| PubChem CID | 145020168 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 3,4-dimethylcyclopentene;(Z)-3,4-dimethylhex-2-ene;ethane |
| SMILES | C/C=C(/C)C(C)CC.CC.CC1C=CCC1C |
| InChI | InChI=1S/C8H16.C7H12.C2H6/c1-5-7(3)8(4)6-2;1-6-4-3-5-7(6)2;1-2/h5,8H,6H2,1-4H3;3-4,6-7H,5H2,1-2H3;1-2H3/b7-5-;; |
| InChIKey | PCNPWCAGEZBRBK-MWKZNRQPSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|