C11H19N — CID 167210010
2-(2,4-diethylcyclopentyl)acetonitrile (PubChem CID 167210010) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-(2,4-diethylcyclopentyl)acetonitrile.
| Compound Name | 2-(2,4-diethylcyclopentyl)acetonitrile |
|---|---|
| PubChem CID | 167210010 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-(2,4-diethylcyclopentyl)acetonitrile |
| SMILES | CCC1CC(CC)C(CC#N)C1 |
| InChI | InChI=1S/C11H19N/c1-3-9-7-10(4-2)11(8-9)5-6-12/h9-11H,3-5,7-8H2,1-2H3 |
| InChIKey | JUHCQFWZCVFJOC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |