C22H40 — CID 159880976
1,4-bis(ethenyl)-2-ethylcyclopentane;1,2,4-triethylcyclopentane (PubChem CID 159880976) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 1,4-bis(ethenyl)-2-ethylcyclopentane;1,2,4-triethylcyclopentane.
| Compound Name | 1,4-bis(ethenyl)-2-ethylcyclopentane;1,2,4-triethylcyclopentane |
|---|---|
| PubChem CID | 159880976 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 1,4-bis(ethenyl)-2-ethylcyclopentane;1,2,4-triethylcyclopentane |
| SMILES | C=CC1CC(C=C)C(CC)C1.CCC1CC(CC)C(CC)C1 |
| InChI | InChI=1S/C11H22.C11H18/c2*1-4-9-7-10(5-2)11(6-3)8-9/h9-11H,4-8H2,1-3H3;4-5,9-11H,1-2,6-8H2,3H3 |
| InChIKey | NTNFDOYLYASGDG-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|