C14H26O2 — CID 23560940
2-[(2,4-diethylcyclopentyl)methyl]-1,3-dioxane (PubChem CID 23560940) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-[(2,4-diethylcyclopentyl)methyl]-1,3-dioxane.
| Compound Name | 2-[(2,4-diethylcyclopentyl)methyl]-1,3-dioxane |
|---|---|
| PubChem CID | 23560940 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-[(2,4-diethylcyclopentyl)methyl]-1,3-dioxane |
| SMILES | CCC1CC(CC)C(CC2OCCCO2)C1 |
| InChI | InChI=1S/C14H26O2/c1-3-11-8-12(4-2)13(9-11)10-14-15-6-5-7-16-14/h11-14H,3-10H2,1-2H3 |
| InChIKey | UUSKEHMGHYQLFJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |