C17H32O3 — CID 23560890
1-(2,4-diethylcyclopentyl)-4-(1,3-dioxan-2-yl)butan-1-ol (PubChem CID 23560890) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-(2,4-diethylcyclopentyl)-4-(1,3-dioxan-2-yl)butan-1-ol.
| Compound Name | 1-(2,4-diethylcyclopentyl)-4-(1,3-dioxan-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 23560890 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1-(2,4-diethylcyclopentyl)-4-(1,3-dioxan-2-yl)butan-1-ol |
| SMILES | CCC1CC(CC)C(C(O)CCCC2OCCCO2)C1 |
| InChI | InChI=1S/C17H32O3/c1-3-13-11-14(4-2)15(12-13)16(18)7-5-8-17-19-9-6-10-20-17/h13-18H,3-12H2,1-2H3 |
| InChIKey | WAKRFWIBJLMCML-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |