C9H18N2O3 — CID 57364810
(2S)-2-amino-5-(1,3-dioxan-2-yl)pentanamide (PubChem CID 57364810) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2S)-2-amino-5-(1,3-dioxan-2-yl)pentanamide.
| Compound Name | (2S)-2-amino-5-(1,3-dioxan-2-yl)pentanamide |
|---|---|
| PubChem CID | 57364810 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2S)-2-amino-5-(1,3-dioxan-2-yl)pentanamide |
| SMILES | NC(=O)[C@@H](N)CCCC1OCCCO1 |
| InChI | InChI=1S/C9H18N2O3/c10-7(9(11)12)3-1-4-8-13-5-2-6-14-8/h7-8H,1-6,10H2,(H2,11,12)/t7-/m0/s1 |
| InChIKey | AISZJZIDUDFEPI-ZETCQYMHSA-N |
| XLogP | -0.27 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |