C7H12F2 — CID 76762029
4-ethyl-1,2-difluorocyclopentane (PubChem CID 76762029) has the molecular formula C7H12F2 and a molecular weight of 134.17 g/mol. Its IUPAC name is 4-ethyl-1,2-difluorocyclopentane.
| Compound Name | 4-ethyl-1,2-difluorocyclopentane |
|---|---|
| PubChem CID | 76762029 |
| Molecular Formula | C7H12F2 |
| Molecular Weight | 134.17 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 4-ethyl-1,2-difluorocyclopentane |
| SMILES | CCC1CC(F)C(F)C1 |
| InChI | InChI=1S/C7H12F2/c1-2-5-3-6(8)7(9)4-5/h5-7H,2-4H2,1H3 |
| InChIKey | MWSANDPLWYCQKH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |