C8H16O — CID 14940085
[(1R,3R)-3-ethylcyclopentyl]methanol (PubChem CID 14940085) has the molecular formula C8H16O and a molecular weight of 128.22 g/mol. Its IUPAC name is [(1R,3R)-3-ethylcyclopentyl]methanol.
| Compound Name | [(1R,3R)-3-ethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 14940085 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | [(1R,3R)-3-ethylcyclopentyl]methanol |
| SMILES | CC[C@@H]1CC[C@@H](CO)C1 |
| InChI | InChI=1S/C8H16O/c1-2-7-3-4-8(5-7)6-9/h7-9H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | OOXRLWVWALNZKU-HTQZYQBOSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |