C11H23P — CID 170151688
(3,5-diethylcycloheptyl)phosphane (PubChem CID 170151688) has the molecular formula C11H23P and a molecular weight of 186.28 g/mol. Its IUPAC name is (3,5-diethylcycloheptyl)phosphane.
| Compound Name | (3,5-diethylcycloheptyl)phosphane |
|---|---|
| PubChem CID | 170151688 |
| Molecular Formula | C11H23P |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (3,5-diethylcycloheptyl)phosphane |
| SMILES | CCC1CCC(P)CC(CC)C1 |
| InChI | InChI=1S/C11H23P/c1-3-9-5-6-11(12)8-10(4-2)7-9/h9-11H,3-8,12H2,1-2H3 |
| InChIKey | UUVRSCGZTHOCKT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|