C35H64 — CID 157459026
5-butyl-6-methyl-4-(4-methylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1-ethyl-4-(3-methylcyclopentyl)cyclohexane (PubChem CID 157459026) has the molecular formula C35H64 and a molecular weight of 484.90 g/mol. Its IUPAC name is 5-butyl-6-methyl-4-(4-methylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1-ethyl-4-(3-methylcyclopentyl)cyclohexane.
| Compound Name | 5-butyl-6-methyl-4-(4-methylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1-ethyl-4-(3-methylcyclopentyl)cyclohexane |
|---|---|
| PubChem CID | 157459026 |
| Molecular Formula | C35H64 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.50 |
| IUPAC Name | 5-butyl-6-methyl-4-(4-methylcyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1-ethyl-4-(3-methylcyclopentyl)cyclohexane |
| SMILES | CCC1CCC(C2CCC(C)C2)CC1.CCCCC1C(C)CC2CCCC2C1C1CCC(C)CC1 |
| InChI | InChI=1S/C21H38.C14H26/c1-4-5-8-19-16(3)14-18-7-6-9-20(18)21(19)17-12-10-15(2)11-13-17;1-3-12-5-8-13(9-6-12)14-7-4-11(2)10-14/h15-21H,4-14H2,1-3H3;11-14H,3-10H2,1-2H3 |
| InChIKey | BTRYHKSSQKIHMU-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |