C22H40 — CID 58552225
4-(2,4-diethylcyclohexyl)-5-ethyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 58552225) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is 4-(2,4-diethylcyclohexyl)-5-ethyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 4-(2,4-diethylcyclohexyl)-5-ethyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 58552225 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | 4-(2,4-diethylcyclohexyl)-5-ethyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCC1CCC(C2C(CC)C(C)CC3CCCC32)C(CC)C1 |
| InChI | InChI=1S/C22H40/c1-5-16-11-12-21(17(6-2)14-16)22-19(7-3)15(4)13-18-9-8-10-20(18)22/h15-22H,5-14H2,1-4H3 |
| InChIKey | IQMOLDPYKLURIO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |