C17H30 — CID 139994332
1-propyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene (PubChem CID 139994332) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 1-propyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene.
| Compound Name | 1-propyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene |
|---|---|
| PubChem CID | 139994332 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 1-propyl-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene |
| SMILES | CCCC1CCCC2CC3CCCCC3CC12 |
| InChI | InChI=1S/C17H30/c1-2-6-13-9-5-10-16-11-14-7-3-4-8-15(14)12-17(13)16/h13-17H,2-12H2,1H3 |
| InChIKey | YIHSCAPYSWQRGY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |