C12H23N — CID 164599276
4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine (PubChem CID 164599276) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine.
| Compound Name | 4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 164599276 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-amine |
| SMILES | CCC1CCC(N)C2CCCCC12 |
| InChI | InChI=1S/C12H23N/c1-2-9-7-8-12(13)11-6-4-3-5-10(9)11/h9-12H,2-8,13H2,1H3 |
| InChIKey | DPVUKSIQBINDCY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |