C11H21N — CID 22484494
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethanamine (PubChem CID 22484494) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethanamine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethanamine |
|---|---|
| PubChem CID | 22484494 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethanamine |
| SMILES | NCC1CCCC2CCCCC12 |
| InChI | InChI=1S/C11H21N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h9-11H,1-8,12H2 |
| InChIKey | JVZJZJXWGKZMLQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |