C18H26 — CID 141010985
4,5-dimethylpentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-ene (PubChem CID 141010985) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 4,5-dimethylpentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-ene.
| Compound Name | 4,5-dimethylpentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-ene |
|---|---|
| PubChem CID | 141010985 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4,5-dimethylpentacyclo[6.6.1.13,6.02,7.09,14]hexadec-4-ene |
| SMILES | CC1=C(C)C2CC1C1C3CC(C4CCCCC43)C21 |
| InChI | InChI=1S/C18H26/c1-9-10(2)14-7-13(9)17-15-8-16(18(14)17)12-6-4-3-5-11(12)15/h11-18H,3-8H2,1-2H3 |
| InChIKey | YMNVICDSRZZCCI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|