C11H14 — CID 102064735
8,9-dimethyltetracyclo[4.3.0.02,4.03,7]non-8-ene (PubChem CID 102064735) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 8,9-dimethyltetracyclo[4.3.0.02,4.03,7]non-8-ene.
| Compound Name | 8,9-dimethyltetracyclo[4.3.0.02,4.03,7]non-8-ene |
|---|---|
| PubChem CID | 102064735 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 8,9-dimethyltetracyclo[4.3.0.02,4.03,7]non-8-ene |
| SMILES | CC1=C(C)C2C3CC4C(C13)C42 |
| InChI | InChI=1S/C11H14/c1-4-5(2)9-6-3-7-10(8(4)6)11(7)9/h6-11H,3H2,1-2H3 |
| InChIKey | BVLNWQUHWKWWBJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|