C11H16 — CID 18640208
(5aR)-6-methyl-1,1a,1b,2,3,4,5,5a-octahydrocyclopropa[a]indene (PubChem CID 18640208) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (5aR)-6-methyl-1,1a,1b,2,3,4,5,5a-octahydrocyclopropa[a]indene.
| Compound Name | (5aR)-6-methyl-1,1a,1b,2,3,4,5,5a-octahydrocyclopropa[a]indene |
|---|---|
| PubChem CID | 18640208 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (5aR)-6-methyl-1,1a,1b,2,3,4,5,5a-octahydrocyclopropa[a]indene |
| SMILES | CC1=C2CC2C2CCCC[C@@H]12 |
| InChI | InChI=1S/C11H16/c1-7-8-4-2-3-5-9(8)11-6-10(7)11/h8-9,11H,2-6H2,1H3/t8-,9?,11?/m0/s1 |
| InChIKey | VAJJKJKZJMGNTB-SILCLGDVSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|