C10H17NO2 — CID 15026585
(1R,4aS,8aS)-1,4-dimethyl-3-oxido-4a,5,6,7,8,8a-hexahydro-1H-2,3-benzoxazin-3-ium (PubChem CID 15026585) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (1R,4aS,8aS)-1,4-dimethyl-3-oxido-4a,5,6,7,8,8a-hexahydro-1H-2,3-benzoxazin-3-ium.
| Compound Name | (1R,4aS,8aS)-1,4-dimethyl-3-oxido-4a,5,6,7,8,8a-hexahydro-1H-2,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 15026585 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (1R,4aS,8aS)-1,4-dimethyl-3-oxido-4a,5,6,7,8,8a-hexahydro-1H-2,3-benzoxazin-3-ium |
| SMILES | CC1=[N+]([O-])O[C@H](C)[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C10H17NO2/c1-7-9-5-3-4-6-10(9)8(2)13-11(7)12/h8-10H,3-6H2,1-2H3/t8-,9-,10-/m1/s1 |
| InChIKey | HUPVNBPQINONKK-OPRDCNLKSA-N |
| XLogP | 2.10 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |