About 1-cyclohexyl-3,3-dimethyldiaziridine
1-cyclohexyl-3,3-dimethyldiaziridine (PubChem CID 71679608) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-cyclohexyl-3,3-dimethyldiaziridine.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,3-dimethyldiaziridine |
| PubChem CID | 71679608 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-cyclohexyl-3,3-dimethyldiaziridine |
| SMILES | CC1(C)NN1C1CCCCC1 |
| InChI | InChI=1S/C9H18N2/c1-9(2)10-11(9)8-6-4-3-5-7-8/h8,10H,3-7H2,1-2H3 |
| InChIKey | HNEUCJXPPJPDCS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3,3-dimethyldiaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,3-dimethyldiaziridine?
The IUPAC name of 1-cyclohexyl-3,3-dimethyldiaziridine (CID 71679608) is 1-cyclohexyl-3,3-dimethyldiaziridine.
What is the SMILES notation for 1-cyclohexyl-3,3-dimethyldiaziridine?
The canonical SMILES for 1-cyclohexyl-3,3-dimethyldiaziridine is CC1(C)NN1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3,3-dimethyldiaziridine?
The InChIKey is HNEUCJXPPJPDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-9(2)10-11(9)8-6-4-3-5-7-8/h8,10H,3-7H2,1-2H3.
What are the key properties of 1-cyclohexyl-3,3-dimethyldiaziridine?
1-cyclohexyl-3,3-dimethyldiaziridine has a molecular weight of 154.26 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,3-dimethyldiaziridine is sourced from PubChem (CID 71679608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).