C14H28N2 — CID 64944315
1-cycloheptyl-3,3-dimethyl-1,4-diazepane (PubChem CID 64944315) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-cycloheptyl-3,3-dimethyl-1,4-diazepane.
| Compound Name | 1-cycloheptyl-3,3-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64944315 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-cycloheptyl-3,3-dimethyl-1,4-diazepane |
| SMILES | CC1(C)CN(C2CCCCCC2)CCCN1 |
| InChI | InChI=1S/C14H28N2/c1-14(2)12-16(11-7-10-15-14)13-8-5-3-4-6-9-13/h13,15H,3-12H2,1-2H3 |
| InChIKey | QBJYZDCVIBGJOK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |