C12H22ClN — CID 131115710
3-chloro-1-cyclohexyl-2,2-dimethylpyrrolidine (PubChem CID 131115710) has the molecular formula C12H22ClN and a molecular weight of 215.77 g/mol. Its IUPAC name is 3-chloro-1-cyclohexyl-2,2-dimethylpyrrolidine.
| Compound Name | 3-chloro-1-cyclohexyl-2,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 131115710 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-chloro-1-cyclohexyl-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)C(Cl)CCN1C1CCCCC1 |
| InChI | InChI=1S/C12H22ClN/c1-12(2)11(13)8-9-14(12)10-6-4-3-5-7-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | XKYGMECCGVYMST-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|