C13H22N2 — CID 117019343
1-cyclopentyl-2,2-dimethylpiperidine-3-carbonitrile (PubChem CID 117019343) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-cyclopentyl-2,2-dimethylpiperidine-3-carbonitrile.
| Compound Name | 1-cyclopentyl-2,2-dimethylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 117019343 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-cyclopentyl-2,2-dimethylpiperidine-3-carbonitrile |
| SMILES | CC1(C)C(C#N)CCCN1C1CCCC1 |
| InChI | InChI=1S/C13H22N2/c1-13(2)11(10-14)6-5-9-15(13)12-7-3-4-8-12/h11-12H,3-9H2,1-2H3 |
| InChIKey | GREBDBYDFQPHHH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |