C9H13N — CID 116841940
2-cyclobutyl-2-methylcyclopropane-1-carbonitrile (PubChem CID 116841940) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-cyclobutyl-2-methylcyclopropane-1-carbonitrile.
| Compound Name | 2-cyclobutyl-2-methylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 116841940 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-cyclobutyl-2-methylcyclopropane-1-carbonitrile |
| SMILES | CC1(C2CCC2)CC1C#N |
| InChI | InChI=1S/C9H13N/c1-9(5-8(9)6-10)7-3-2-4-7/h7-8H,2-5H2,1H3 |
| InChIKey | FDDDWNIAHYHMAG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |