C6H10O — CID 124541760
(1R,2R,5R)-bicyclo[3.1.0]hexan-2-ol (PubChem CID 124541760) has the molecular formula C6H10O and a molecular weight of 98.14 g/mol. Its IUPAC name is (1R,2R,5R)-bicyclo[3.1.0]hexan-2-ol.
| Compound Name | (1R,2R,5R)-bicyclo[3.1.0]hexan-2-ol |
|---|---|
| PubChem CID | 124541760 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | (1R,2R,5R)-bicyclo[3.1.0]hexan-2-ol |
| SMILES | O[C@@H]1CC[C@@H]2C[C@H]21 |
| InChI | InChI=1S/C6H10O/c7-6-2-1-4-3-5(4)6/h4-7H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | DXESCHCZVDAYPL-HSUXUTPPSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |