C19H23N2O5P — CID 10134965
N-hydroxy-2-[2-oxo-2-(4-phenylmethoxyphenyl)-1,3,2λ5-oxazaphosphepan-3-yl]acetamide (PubChem CID 10134965) has the molecular formula C19H23N2O5P and a molecular weight of 390.38 g/mol. Its IUPAC name is N-hydroxy-2-[2-oxo-2-(4-phenylmethoxyphenyl)-1,3,2λ5-oxazaphosphepan-3-yl]acetamide.
| Compound Name | N-hydroxy-2-[2-oxo-2-(4-phenylmethoxyphenyl)-1,3,2λ5-oxazaphosphepan-3-yl]acetamide |
|---|---|
| PubChem CID | 10134965 |
| Molecular Formula | C19H23N2O5P |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-hydroxy-2-[2-oxo-2-(4-phenylmethoxyphenyl)-1,3,2λ5-oxazaphosphepan-3-yl]acetamide |
| SMILES | O=C(CN1CCCCOP1(=O)c1ccc(OCc2ccccc2)cc1)NO |
| InChI | InChI=1S/C19H23N2O5P/c22-19(20-23)14-21-12-4-5-13-26-27(21,24)18-10-8-17(9-11-18)25-15-16-6-2-1-3-7-16/h1-3,6-11,23H,4-5,12-15H2,(H,20,22) |
| InChIKey | GTAPUZDVNGLHMB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|