C48H70N4O6 — CID 155007175
ethyl (2S)-2-[7-tert-butyl-4,10-bis[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]-4-phenylbutanoate (PubChem CID 155007175) has the molecular formula C48H70N4O6 and a molecular weight of 799.11 g/mol. Its IUPAC name is ethyl (2S)-2-[7-tert-butyl-4,10-bis[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[7-tert-butyl-4,10-bis[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 155007175 |
| Molecular Formula | C48H70N4O6 |
| Molecular Weight | 799.11 g/mol |
| Exact Mass | 798.53 |
| IUPAC Name | ethyl (2S)-2-[7-tert-butyl-4,10-bis[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N1CCN([C@@H](CCc2ccccc2)C(=O)OCC)CCN(C(C)(C)C)CCN([C@@H](CCc2ccccc2)C(=O)OCC)CC1 |
| InChI | InChI=1S/C48H70N4O6/c1-7-56-45(53)42(28-25-39-19-13-10-14-20-39)49-31-33-50(43(46(54)57-8-2)29-26-40-21-15-11-16-22-40)35-37-52(48(4,5)6)38-36-51(34-32-49)44(47(55)58-9-3)30-27-41-23-17-12-18-24-41/h10-24,42-44H,7-9,25-38H2,1-6H3/t42-,43-,44-/m0/s1 |
| InChIKey | LTQPEFTYFHOZNF-KJFLPAQCSA-N |
| XLogP | 6.70 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.11 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|