C30H46N4O9S2 — CID 176872296
6-[3,5-bis(methylsulfanylmethyl)phenyl]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid (PubChem CID 176872296) has the molecular formula C30H46N4O9S2 and a molecular weight of 670.85 g/mol. Its IUPAC name is 6-[3,5-bis(methylsulfanylmethyl)phenyl]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid.
| Compound Name | 6-[3,5-bis(methylsulfanylmethyl)phenyl]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 176872296 |
| Molecular Formula | C30H46N4O9S2 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 6-[3,5-bis(methylsulfanylmethyl)phenyl]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
| SMILES | CSCc1cc(CSC)cc(CC(=O)CCC(C(=O)O)N2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1 |
| InChI | InChI=1S/C30H46N4O9S2/c1-44-20-23-13-22(14-24(15-23)21-45-2)16-25(35)3-4-26(30(42)43)34-11-9-32(18-28(38)39)7-5-31(17-27(36)37)6-8-33(10-12-34)19-29(40)41/h13-15,26H,3-12,16-21H2,1-2H3,(H,36,37)(H,38,39)(H,40,41)(H,42,43) |
| InChIKey | RNPZGMNNWAPRKF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 179.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |