C27H44N4O9S — CID 91492800
2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-11-(1-ethyl-2,5-dihydroxypyrrol-3-yl)sulfanyl-5-oxoundecanoic acid (PubChem CID 91492800) has the molecular formula C27H44N4O9S and a molecular weight of 600.74 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-11-(1-ethyl-2,5-dihydroxypyrrol-3-yl)sulfanyl-5-oxoundecanoic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-11-(1-ethyl-2,5-dihydroxypyrrol-3-yl)sulfanyl-5-oxoundecanoic acid |
|---|---|
| PubChem CID | 91492800 |
| Molecular Formula | C27H44N4O9S |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-11-(1-ethyl-2,5-dihydroxypyrrol-3-yl)sulfanyl-5-oxoundecanoic acid |
| SMILES | CCn1c(O)cc(SCCCCCCC(=O)CCC(C(=O)O)N2CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1O |
| InChI | InChI=1S/C27H44N4O9S/c1-2-31-23(33)17-22(26(31)38)41-16-6-4-3-5-7-20(32)8-9-21(27(39)40)30-14-12-28(18-24(34)35)10-11-29(13-15-30)19-25(36)37/h17,21,33,38H,2-16,18-19H2,1H3,(H,34,35)(H,36,37)(H,39,40) |
| InChIKey | BCKMBTBDLJUQHM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 184.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|