C42H75N5O16 — CID 58232780
9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]nonanoic acid (PubChem CID 58232780) has the molecular formula C42H75N5O16 and a molecular weight of 906.08 g/mol. Its IUPAC name is 9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]nonanoic acid.
| Compound Name | 9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]nonanoic acid |
|---|---|
| PubChem CID | 58232780 |
| Molecular Formula | C42H75N5O16 |
| Molecular Weight | 906.08 g/mol |
| Exact Mass | 905.52 |
| IUPAC Name | 9-[2-[2-[6-[acetyl-[3-(2-ethoxyethoxy)propyl]amino]-5-oxohexoxy]ethoxy]ethoxy]-5-oxo-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]nonanoic acid |
| SMILES | CCOCCOCCCN(CC(=O)CCCCOCCOCCOCCCCC(=O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C(C)=O |
| InChI | InChI=1S/C42H75N5O16/c1-3-59-25-26-62-24-8-13-47(35(2)48)31-37(50)10-5-7-23-61-28-30-63-29-27-60-22-6-4-9-36(49)11-12-38(42(57)58)46-20-18-44(33-40(53)54)16-14-43(32-39(51)52)15-17-45(19-21-46)34-41(55)56/h38H,3-34H2,1-2H3,(H,51,52)(H,53,54)(H,55,56)(H,57,58) |
| InChIKey | MEAUPAYDKBPKID-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 262.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.08 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|