C16H28N4O7 — CID 177187676
4-(1-carboxy-4-oxobutyl)-10-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid (PubChem CID 177187676) has the molecular formula C16H28N4O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-(1-carboxy-4-oxobutyl)-10-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid.
| Compound Name | 4-(1-carboxy-4-oxobutyl)-10-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid |
|---|---|
| PubChem CID | 177187676 |
| Molecular Formula | C16H28N4O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-(1-carboxy-4-oxobutyl)-10-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid |
| SMILES | CN1CCN(C(=O)O)CCN(C(CCC=O)C(=O)O)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C16H28N4O7/c1-17-4-6-19(15(24)25)10-8-18(13(14(22)23)3-2-12-21)9-11-20(7-5-17)16(26)27/h12-13H,2-11H2,1H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | YMLIKZUXEQANEW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|