C19H25Cl2N3O6S — CID 138566963
3,4-dichloro-N-[(2S)-4-(3-methoxyoxiran-2-yl)-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]benzamide (PubChem CID 138566963) has the molecular formula C19H25Cl2N3O6S and a molecular weight of 494.40 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2S)-4-(3-methoxyoxiran-2-yl)-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2S)-4-(3-methoxyoxiran-2-yl)-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 138566963 |
| Molecular Formula | C19H25Cl2N3O6S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 3,4-dichloro-N-[(2S)-4-(3-methoxyoxiran-2-yl)-1-(4-methylsulfonylpiperazin-1-yl)-1-oxobutan-2-yl]benzamide |
| SMILES | COC1OC1CC[C@H](NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H25Cl2N3O6S/c1-29-19-16(30-19)6-5-15(22-17(25)12-3-4-13(20)14(21)11-12)18(26)23-7-9-24(10-8-23)31(2,27)28/h3-4,11,15-16,19H,5-10H2,1-2H3,(H,22,25)/t15-,16?,19?/m0/s1 |
| InChIKey | MGXCDCBWKWMYGP-LYGPFTKASA-N |
| XLogP | 1.35 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|