C18H27ClN2O4S — CID 72930889
3-chloro-N-[(2R)-3-methylbutan-2-yl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide (PubChem CID 72930889) has the molecular formula C18H27ClN2O4S and a molecular weight of 402.94 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-3-methylbutan-2-yl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide.
| Compound Name | 3-chloro-N-[(2R)-3-methylbutan-2-yl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide |
|---|---|
| PubChem CID | 72930889 |
| Molecular Formula | C18H27ClN2O4S |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-chloro-N-[(2R)-3-methylbutan-2-yl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide |
| SMILES | CC(C)[C@@H](C)NC(=O)c1ccc(OC2CCN(S(C)(=O)=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H27ClN2O4S/c1-12(2)13(3)20-18(22)14-5-6-17(16(19)11-14)25-15-7-9-21(10-8-15)26(4,23)24/h5-6,11-13,15H,7-10H2,1-4H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | LQBYBJAJCWDTKI-CYBMUJFWSA-N |
| XLogP | 2.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |