C18H25ClN2O4S — CID 72870356
[3-chloro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone (PubChem CID 72870356) has the molecular formula C18H25ClN2O4S and a molecular weight of 400.93 g/mol. Its IUPAC name is [3-chloro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-chloro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 72870356 |
| Molecular Formula | C18H25ClN2O4S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [3-chloro-4-(1-methylsulfonylpiperidin-4-yl)oxyphenyl]-piperidin-1-ylmethanone |
| SMILES | CS(=O)(=O)N1CCC(Oc2ccc(C(=O)N3CCCCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C18H25ClN2O4S/c1-26(23,24)21-11-7-15(8-12-21)25-17-6-5-14(13-16(17)19)18(22)20-9-3-2-4-10-20/h5-6,13,15H,2-4,7-12H2,1H3 |
| InChIKey | KFLVFADIJWEZEJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |