C19H30ClN3O4S — CID 42462227
3-chloro-N-[2-(diethylamino)ethyl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide (PubChem CID 42462227) has the molecular formula C19H30ClN3O4S and a molecular weight of 431.99 g/mol. Its IUPAC name is 3-chloro-N-[2-(diethylamino)ethyl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide.
| Compound Name | 3-chloro-N-[2-(diethylamino)ethyl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide |
|---|---|
| PubChem CID | 42462227 |
| Molecular Formula | C19H30ClN3O4S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-chloro-N-[2-(diethylamino)ethyl]-4-(1-methylsulfonylpiperidin-4-yl)oxybenzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(OC2CCN(S(C)(=O)=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H30ClN3O4S/c1-4-22(5-2)13-10-21-19(24)15-6-7-18(17(20)14-15)27-16-8-11-23(12-9-16)28(3,25)26/h6-7,14,16H,4-5,8-13H2,1-3H3,(H,21,24) |
| InChIKey | PGPJIELATCRGQH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |