C21H30ClN3O3 — CID 42565360
3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(3-methylbut-2-enoyl)piperidin-4-yl]oxybenzamide (PubChem CID 42565360) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is 3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(3-methylbut-2-enoyl)piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(3-methylbut-2-enoyl)piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42565360 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(3-methylbut-2-enoyl)piperidin-4-yl]oxybenzamide |
| SMILES | CC(C)=CC(=O)N1CCC(Oc2ccc(C(=O)NCCN(C)C)cc2Cl)CC1 |
| InChI | InChI=1S/C21H30ClN3O3/c1-15(2)13-20(26)25-10-7-17(8-11-25)28-19-6-5-16(14-18(19)22)21(27)23-9-12-24(3)4/h5-6,13-14,17H,7-12H2,1-4H3,(H,23,27) |
| InChIKey | FLRQXRYZAIQZFG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|