C20H30ClN3O2S — CID 45213969
3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(thiolan-3-yl)piperidin-4-yl]oxybenzamide (PubChem CID 45213969) has the molecular formula C20H30ClN3O2S and a molecular weight of 412.00 g/mol. Its IUPAC name is 3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(thiolan-3-yl)piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(thiolan-3-yl)piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 45213969 |
| Molecular Formula | C20H30ClN3O2S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-chloro-N-[2-(dimethylamino)ethyl]-4-[1-(thiolan-3-yl)piperidin-4-yl]oxybenzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(OC2CCN(C3CCSC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H30ClN3O2S/c1-23(2)11-8-22-20(25)15-3-4-19(18(21)13-15)26-17-5-9-24(10-6-17)16-7-12-27-14-16/h3-4,13,16-17H,5-12,14H2,1-2H3,(H,22,25) |
| InChIKey | JHKVMOTWXKPYIC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |