C22H33ClN2O3 — CID 26407252
3-chloro-4-(1-cycloheptylpiperidin-4-yl)oxy-N-(2-methoxyethyl)benzamide (PubChem CID 26407252) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is 3-chloro-4-(1-cycloheptylpiperidin-4-yl)oxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-chloro-4-(1-cycloheptylpiperidin-4-yl)oxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 26407252 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-chloro-4-(1-cycloheptylpiperidin-4-yl)oxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(OC2CCN(C3CCCCCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H33ClN2O3/c1-27-15-12-24-22(26)17-8-9-21(20(23)16-17)28-19-10-13-25(14-11-19)18-6-4-2-3-5-7-18/h8-9,16,18-19H,2-7,10-15H2,1H3,(H,24,26) |
| InChIKey | XDYYTKMBFZVCJD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|